C12H14N4O4 — CID 62688696
4-amino-N-[3-(2-methoxyethoxy)phenyl]-1,2,5-oxadiazole-3-carboxamide (PubChem CID 62688696) has the molecular formula C12H14N4O4 and a molecular weight of 278.27 g/mol. Its IUPAC name is 4-amino-N-[3-(2-methoxyethoxy)phenyl]-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | 4-amino-N-[3-(2-methoxyethoxy)phenyl]-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 62688696 |
| Molecular Formula | C12H14N4O4 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 4-amino-N-[3-(2-methoxyethoxy)phenyl]-1,2,5-oxadiazole-3-carboxamide |
| SMILES | COCCOc1cccc(NC(=O)c2nonc2N)c1 |
| InChI | InChI=1S/C12H14N4O4/c1-18-5-6-19-9-4-2-3-8(7-9)14-12(17)10-11(13)16-20-15-10/h2-4,7H,5-6H2,1H3,(H2,13,16)(H,14,17) |
| InChIKey | DDVZKYZBKHLDNT-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|