C5H10N4O — CID 62691759
2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol (PubChem CID 62691759) has the molecular formula C5H10N4O and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol.
| Compound Name | 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol |
|---|---|
| PubChem CID | 62691759 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 2-amino-2-(4-methyl-1,2,4-triazol-3-yl)ethanol |
| SMILES | Cn1cnnc1C(N)CO |
| InChI | InChI=1S/C5H10N4O/c1-9-3-7-8-5(9)4(6)2-10/h3-4,10H,2,6H2,1H3 |
| InChIKey | KFADKSJJPPUWKL-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |