C10H22N2O2S — CID 62693591
3-N-methyl-1,1-dioxo-3-N-pentan-3-ylthiolane-3,4-diamine (PubChem CID 62693591) has the molecular formula C10H22N2O2S and a molecular weight of 234.36 g/mol. Its IUPAC name is 3-N-methyl-1,1-dioxo-3-N-pentan-3-ylthiolane-3,4-diamine.
| Compound Name | 3-N-methyl-1,1-dioxo-3-N-pentan-3-ylthiolane-3,4-diamine |
|---|---|
| PubChem CID | 62693591 |
| Molecular Formula | C10H22N2O2S |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 3-N-methyl-1,1-dioxo-3-N-pentan-3-ylthiolane-3,4-diamine |
| SMILES | CCC(CC)N(C)C1CS(=O)(=O)CC1N |
| InChI | InChI=1S/C10H22N2O2S/c1-4-8(5-2)12(3)10-7-15(13,14)6-9(10)11/h8-10H,4-7,11H2,1-3H3 |
| InChIKey | AYOPLEDYVKYISZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |