C8H17N3O3S — CID 103102710
2-[(4-amino-1,1-dioxothiolan-3-yl)-ethylamino]acetamide (PubChem CID 103102710) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 2-[(4-amino-1,1-dioxothiolan-3-yl)-ethylamino]acetamide.
| Compound Name | 2-[(4-amino-1,1-dioxothiolan-3-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 103102710 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2-[(4-amino-1,1-dioxothiolan-3-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)C1CS(=O)(=O)CC1N |
| InChI | InChI=1S/C8H17N3O3S/c1-2-11(3-8(10)12)7-5-15(13,14)4-6(7)9/h6-7H,2-5,9H2,1H3,(H2,10,12) |
| InChIKey | WLRCPRJAPWCQSD-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |