About 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid
2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid (PubChem CID 62697061) has the molecular formula C14H13N3O4
and a molecular weight of 287.28 g/mol. Its IUPAC name is 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid |
| PubChem CID | 62697061 |
| Molecular Formula | C14H13N3O4 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid |
| SMILES | O=C(NC(C(=O)O)C1CC1)c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C14H13N3O4/c18-12(16-11(14(19)20)8-1-2-8)9-3-5-10(6-4-9)13-17-15-7-21-13/h3-8,11H,1-2H2,(H,16,18)(H,19,20) |
| InChIKey | OKQXYBSSENTLOK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid?
The IUPAC name of 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid (CID 62697061) is 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid.
What is the SMILES notation for 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid?
The canonical SMILES for 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid is O=C(NC(C(=O)O)C1CC1)c1ccc(-c2nnco2)cc1.
What is the InChIKey of 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid?
The InChIKey is OKQXYBSSENTLOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O4/c18-12(16-11(14(19)20)8-1-2-8)9-3-5-10(6-4-9)13-17-15-7-21-13/h3-8,11H,1-2H2,(H,16,18)(H,19,20).
What are the key properties of 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid?
2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid has a molecular weight of 287.28 g/mol, XLogP of 1.33, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-[[4-(1,3,4-oxadiazol-2-yl)benzoyl]amino]acetic acid is sourced from PubChem (CID 62697061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).