C16H19N3O2 — CID 9084335
N-[(1R,2R)-2-methylcyclohexyl]-4-(1,3,4-oxadiazol-2-yl)benzamide (PubChem CID 9084335) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-4-(1,3,4-oxadiazol-2-yl)benzamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-4-(1,3,4-oxadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 9084335 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-4-(1,3,4-oxadiazol-2-yl)benzamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=O)c1ccc(-c2nnco2)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-11-4-2-3-5-14(11)18-15(20)12-6-8-13(9-7-12)16-19-17-10-21-16/h6-11,14H,2-5H2,1H3,(H,18,20)/t11-,14-/m1/s1 |
| InChIKey | ZADJSSHYFYUNRE-BXUZGUMPSA-N |
| XLogP | 3.05 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |