C11H19N3O — CID 62697979
N-cyclopropyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide (PubChem CID 62697979) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide.
| Compound Name | N-cyclopropyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 62697979 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | N-cyclopropyl-2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrole-1-carboxamide |
| SMILES | CC1CC2CNCC2N1C(=O)NC1CC1 |
| InChI | InChI=1S/C11H19N3O/c1-7-4-8-5-12-6-10(8)14(7)11(15)13-9-2-3-9/h7-10,12H,2-6H2,1H3,(H,13,15) |
| InChIKey | HTGWSDCHZMORRY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |