C13H22N2O2 — CID 65160130
1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-2-(oxolan-2-yl)ethanone (PubChem CID 65160130) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-2-(oxolan-2-yl)ethanone.
| Compound Name | 1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-2-(oxolan-2-yl)ethanone |
|---|---|
| PubChem CID | 65160130 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 1-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)-2-(oxolan-2-yl)ethanone |
| SMILES | CC1CC2CNCC2N1C(=O)CC1CCCO1 |
| InChI | InChI=1S/C13H22N2O2/c1-9-5-10-7-14-8-12(10)15(9)13(16)6-11-3-2-4-17-11/h9-12,14H,2-8H2,1H3 |
| InChIKey | UBAZKLGTBMNOQZ-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |