C14H25N3O — CID 79151943
azepan-1-yl-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone (PubChem CID 79151943) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is azepan-1-yl-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone.
| Compound Name | azepan-1-yl-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone |
|---|---|
| PubChem CID | 79151943 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | azepan-1-yl-(2-methyl-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[2,3-c]pyrrol-1-yl)methanone |
| SMILES | CC1CC2CNCC2N1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C14H25N3O/c1-11-8-12-9-15-10-13(12)17(11)14(18)16-6-4-2-3-5-7-16/h11-13,15H,2-10H2,1H3 |
| InChIKey | QBWHHGMRCUVWKJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |