C9H13NO3 — CID 62706913
ethyl (1S,5S,6S)-5-hydroxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate (PubChem CID 62706913) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is ethyl (1S,5S,6S)-5-hydroxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate.
| Compound Name | ethyl (1S,5S,6S)-5-hydroxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate |
|---|---|
| PubChem CID | 62706913 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | ethyl (1S,5S,6S)-5-hydroxy-7-azabicyclo[4.1.0]hept-2-ene-3-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H]2N[C@@H]2[C@@H](O)C1 |
| InChI | InChI=1S/C9H13NO3/c1-2-13-9(12)5-3-6-8(10-6)7(11)4-5/h3,6-8,10-11H,2,4H2,1H3/t6-,7-,8-/m0/s1 |
| InChIKey | ZEJSSACSBSZYER-FXQIFTODSA-N |
| XLogP | -0.42 |
| TPSA | 68.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|