C44H30N4O2Zn — CID 62707161
zinc 5-methoxy-2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene (PubChem CID 62707161) has the molecular formula C44H30N4O2Zn and a molecular weight of 712.14 g/mol. Its IUPAC name is zinc 5-methoxy-2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene.
| Compound Name | zinc 5-methoxy-2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene |
|---|---|
| PubChem CID | 62707161 |
| Molecular Formula | C44H30N4O2Zn |
| Molecular Weight | 712.14 g/mol |
| Exact Mass | 710.17 |
| IUPAC Name | zinc 5-methoxy-2,7,12,17-tetraphenyl-4-oxa-22,24-diaza-21,23-diazanidapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1(20),2,6(24),7,9,11,13(22),14,16,18-decaene |
| SMILES | COC1Oc2nc1c(-c1ccccc1)c1ccc([n-]1)c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([n-]3)c2-c2ccccc2)C=C1.[Zn+2] |
| InChI | InChI=1S/C44H30N4O2.Zn/c1-49-44-42-40(30-18-10-4-11-19-30)36-26-24-34(46-36)38(28-14-6-2-7-15-28)32-22-23-33(45-32)39(29-16-8-3-9-17-29)35-25-27-37(47-35)41(43(48-42)50-44)31-20-12-5-13-21-31;/h2-27,44H,1H3;/q-2;+2/b38-32-,38-34-,39-33-,39-35-,40-36-,41-37-,42-40-,43-41+; |
| InChIKey | QOBVLFQGQVDURA-USEAPTHLSA-N |
| XLogP | 10.13 |
| TPSA | 72.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.14 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|