C18H37N3 — CID 62708869
2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-4-propan-2-ylcyclohexan-1-amine (PubChem CID 62708869) has the molecular formula C18H37N3 and a molecular weight of 295.52 g/mol. Its IUPAC name is 2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-4-propan-2-ylcyclohexan-1-amine.
| Compound Name | 2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-4-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 62708869 |
| Molecular Formula | C18H37N3 |
| Molecular Weight | 295.52 g/mol |
| Exact Mass | 295.30 |
| IUPAC Name | 2-[[4-[(dimethylamino)methyl]piperidin-1-yl]methyl]-4-propan-2-ylcyclohexan-1-amine |
| SMILES | CC(C)C1CCC(N)C(CN2CCC(CN(C)C)CC2)C1 |
| InChI | InChI=1S/C18H37N3/c1-14(2)16-5-6-18(19)17(11-16)13-21-9-7-15(8-10-21)12-20(3)4/h14-18H,5-13,19H2,1-4H3 |
| InChIKey | CRKRJPOMDMSUEI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |