C15H20O3S — CID 62721365
2-[(3-methylcyclohexyl)sulfinylmethyl]benzoic acid (PubChem CID 62721365) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 2-[(3-methylcyclohexyl)sulfinylmethyl]benzoic acid.
| Compound Name | 2-[(3-methylcyclohexyl)sulfinylmethyl]benzoic acid |
|---|---|
| PubChem CID | 62721365 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-[(3-methylcyclohexyl)sulfinylmethyl]benzoic acid |
| SMILES | CC1CCCC(S(=O)Cc2ccccc2C(=O)O)C1 |
| InChI | InChI=1S/C15H20O3S/c1-11-5-4-7-13(9-11)19(18)10-12-6-2-3-8-14(12)15(16)17/h2-3,6,8,11,13H,4-5,7,9-10H2,1H3,(H,16,17) |
| InChIKey | LDPIKKFUHUVLFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |