C17H27NO2S — CID 81332910
[2-[3-(3-methylcyclohexyl)sulfinylpropoxy]phenyl]methanamine (PubChem CID 81332910) has the molecular formula C17H27NO2S and a molecular weight of 309.47 g/mol. Its IUPAC name is [2-[3-(3-methylcyclohexyl)sulfinylpropoxy]phenyl]methanamine.
| Compound Name | [2-[3-(3-methylcyclohexyl)sulfinylpropoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 81332910 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | [2-[3-(3-methylcyclohexyl)sulfinylpropoxy]phenyl]methanamine |
| SMILES | CC1CCCC(S(=O)CCCOc2ccccc2CN)C1 |
| InChI | InChI=1S/C17H27NO2S/c1-14-6-4-8-16(12-14)21(19)11-5-10-20-17-9-3-2-7-15(17)13-18/h2-3,7,9,14,16H,4-6,8,10-13,18H2,1H3 |
| InChIKey | GXIITEDQXHRWOJ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|