C17H27NO2S — CID 64658392
1-(2-ethoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanamine (PubChem CID 64658392) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanamine.
| Compound Name | 1-(2-ethoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanamine |
|---|---|
| PubChem CID | 64658392 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-(2-ethoxyphenyl)-2-(3-methylcyclohexyl)sulfinylethanamine |
| SMILES | CCOc1ccccc1C(N)CS(=O)C1CCCC(C)C1 |
| InChI | InChI=1S/C17H27NO2S/c1-3-20-17-10-5-4-9-15(17)16(18)12-21(19)14-8-6-7-13(2)11-14/h4-5,9-10,13-14,16H,3,6-8,11-12,18H2,1-2H3 |
| InChIKey | FAGJUMKHWHEQQW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |