C13H16Cl2N2O2 — CID 62729410
3-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]-N,2-dimethylpropanamide (PubChem CID 62729410) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is 3-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]-N,2-dimethylpropanamide.
| Compound Name | 3-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 62729410 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 3-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]-N,2-dimethylpropanamide |
| SMILES | CC(CCl)C(=O)N(C)CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-9(7-14)13(19)17(2)8-12(18)16-11-5-3-10(15)4-6-11/h3-6,9H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | FMELEMCWCAONBH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|