C16H16N4 — CID 62733002
2-methyl-5-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)aniline (PubChem CID 62733002) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 2-methyl-5-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)aniline.
| Compound Name | 2-methyl-5-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)aniline |
|---|---|
| PubChem CID | 62733002 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-methyl-5-(2-methyl-5-phenyl-1,2,4-triazol-3-yl)aniline |
| SMILES | Cc1ccc(-c2nc(-c3ccccc3)nn2C)cc1N |
| InChI | InChI=1S/C16H16N4/c1-11-8-9-13(10-14(11)17)16-18-15(19-20(16)2)12-6-4-3-5-7-12/h3-10H,17H2,1-2H3 |
| InChIKey | WAAZNZJOZPPVMG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|