C14H14N4 — CID 83966915
2-methyl-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline (PubChem CID 83966915) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-methyl-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline.
| Compound Name | 2-methyl-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 83966915 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 2-methyl-5-(5-methyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)aniline |
| SMILES | Cc1ccc(-c2nc3cccc(C)n3n2)cc1N |
| InChI | InChI=1S/C14H14N4/c1-9-6-7-11(8-12(9)15)14-16-13-5-3-4-10(2)18(13)17-14/h3-8H,15H2,1-2H3 |
| InChIKey | PFDLERKXYSEBJG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|