C12H16N4S — CID 62734713
3-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidine (PubChem CID 62734713) has the molecular formula C12H16N4S and a molecular weight of 248.35 g/mol. Its IUPAC name is 3-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidine.
| Compound Name | 3-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidine |
|---|---|
| PubChem CID | 62734713 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 3-[(3-thiophen-2-yl-1H-1,2,4-triazol-5-yl)methyl]piperidine |
| SMILES | c1csc(-c2n[nH]c(CC3CCCNC3)n2)c1 |
| InChI | InChI=1S/C12H16N4S/c1-3-9(8-13-5-1)7-11-14-12(16-15-11)10-4-2-6-17-10/h2,4,6,9,13H,1,3,5,7-8H2,(H,14,15,16) |
| InChIKey | ROZNBHJNVHUQSS-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |