C8H10N4O — CID 62735140
N-(cyanomethyl)-N,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 62735140) has the molecular formula C8H10N4O and a molecular weight of 178.19 g/mol. Its IUPAC name is N-(cyanomethyl)-N,5-dimethyl-1H-pyrazole-4-carboxamide.
| Compound Name | N-(cyanomethyl)-N,5-dimethyl-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 62735140 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | N-(cyanomethyl)-N,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1[nH]ncc1C(=O)N(C)CC#N |
| InChI | InChI=1S/C8H10N4O/c1-6-7(5-10-11-6)8(13)12(2)4-3-9/h5H,4H2,1-2H3,(H,10,11) |
| InChIKey | SOURADAZKDRVDS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|