C11H15N3O5 — CID 63997835
methyl 2-[(2-methoxy-2-oxoethyl)-(5-methyl-1H-pyrazole-4-carbonyl)amino]acetate (PubChem CID 63997835) has the molecular formula C11H15N3O5 and a molecular weight of 269.26 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-2-oxoethyl)-(5-methyl-1H-pyrazole-4-carbonyl)amino]acetate.
| Compound Name | methyl 2-[(2-methoxy-2-oxoethyl)-(5-methyl-1H-pyrazole-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 63997835 |
| Molecular Formula | C11H15N3O5 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | methyl 2-[(2-methoxy-2-oxoethyl)-(5-methyl-1H-pyrazole-4-carbonyl)amino]acetate |
| SMILES | COC(=O)CN(CC(=O)OC)C(=O)c1cn[nH]c1C |
| InChI | InChI=1S/C11H15N3O5/c1-7-8(4-12-13-7)11(17)14(5-9(15)18-2)6-10(16)19-3/h4H,5-6H2,1-3H3,(H,12,13) |
| InChIKey | CNXQWJGUBIZKQV-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |