About [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol
[(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 62735343) has the molecular formula C10H16N2OS
and a molecular weight of 212.32 g/mol. Its IUPAC name is [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol |
| PubChem CID | 62735343 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | Cc1ncc(CN2CCC[C@@H]2CO)s1 |
| InChI | InChI=1S/C10H16N2OS/c1-8-11-5-10(14-8)6-12-4-2-3-9(12)7-13/h5,9,13H,2-4,6-7H2,1H3/t9-/m1/s1 |
| InChIKey | CBVCLEFPGHGNCG-SECBINFHSA-N |
| XLogP | 1.41 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol (CID 62735343) is [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol is Cc1ncc(CN2CCC[C@@H]2CO)s1.
What is the InChIKey of [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol?
The InChIKey is CBVCLEFPGHGNCG-SECBINFHSA-N. The full InChI is InChI=1S/C10H16N2OS/c1-8-11-5-10(14-8)6-12-4-2-3-9(12)7-13/h5,9,13H,2-4,6-7H2,1H3/t9-/m1/s1.
What are the key properties of [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol?
[(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol has a molecular weight of 212.32 g/mol, XLogP of 1.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-[(2-methyl-1,3-thiazol-5-yl)methyl]pyrrolidin-2-yl]methanol is sourced from PubChem (CID 62735343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).