C16H22N4 — CID 62745258
3-(4,6-dimethyl-2-pyridin-4-ylpyrimidin-5-yl)-N-ethylpropan-1-amine (PubChem CID 62745258) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-pyridin-4-ylpyrimidin-5-yl)-N-ethylpropan-1-amine.
| Compound Name | 3-(4,6-dimethyl-2-pyridin-4-ylpyrimidin-5-yl)-N-ethylpropan-1-amine |
|---|---|
| PubChem CID | 62745258 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 3-(4,6-dimethyl-2-pyridin-4-ylpyrimidin-5-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCCCc1c(C)nc(-c2ccncc2)nc1C |
| InChI | InChI=1S/C16H22N4/c1-4-17-9-5-6-15-12(2)19-16(20-13(15)3)14-7-10-18-11-8-14/h7-8,10-11,17H,4-6,9H2,1-3H3 |
| InChIKey | QSXYDWRWIFXVIS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|