C16H19Cl2N3 — CID 62746219
N-[[2-[(2,6-dichlorophenyl)methyl]-6-methylpyrimidin-4-yl]methyl]propan-1-amine (PubChem CID 62746219) has the molecular formula C16H19Cl2N3 and a molecular weight of 324.26 g/mol. Its IUPAC name is N-[[2-[(2,6-dichlorophenyl)methyl]-6-methylpyrimidin-4-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(2,6-dichlorophenyl)methyl]-6-methylpyrimidin-4-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 62746219 |
| Molecular Formula | C16H19Cl2N3 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | N-[[2-[(2,6-dichlorophenyl)methyl]-6-methylpyrimidin-4-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cc(C)nc(Cc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C16H19Cl2N3/c1-3-7-19-10-12-8-11(2)20-16(21-12)9-13-14(17)5-4-6-15(13)18/h4-6,8,19H,3,7,9-10H2,1-2H3 |
| InChIKey | CXBSGLGPUZBAFM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|