C13H14N2OS — CID 62752443
1-[2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]ethanol (PubChem CID 62752443) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]ethanol.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]ethanol |
|---|---|
| PubChem CID | 62752443 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]ethanol |
| SMILES | CC(O)c1cnc(N2CCc3ccccc32)s1 |
| InChI | InChI=1S/C13H14N2OS/c1-9(16)12-8-14-13(17-12)15-7-6-10-4-2-3-5-11(10)15/h2-5,8-9,16H,6-7H2,1H3 |
| InChIKey | ITPABLOOXYBXEY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |