C15H17Cl2N3O — CID 62756617
N-[[2-[(2,4-dichlorophenyl)methyl]pyrimidin-5-yl]methyl]-2-methoxyethanamine (PubChem CID 62756617) has the molecular formula C15H17Cl2N3O and a molecular weight of 326.23 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methyl]pyrimidin-5-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methyl]pyrimidin-5-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 62756617 |
| Molecular Formula | C15H17Cl2N3O |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methyl]pyrimidin-5-yl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1cnc(Cc2ccc(Cl)cc2Cl)nc1 |
| InChI | InChI=1S/C15H17Cl2N3O/c1-21-5-4-18-8-11-9-19-15(20-10-11)6-12-2-3-13(16)7-14(12)17/h2-3,7,9-10,18H,4-6,8H2,1H3 |
| InChIKey | KGPPUMJKFGGVML-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|