C13H18N2OS — CID 62757088
2-(azepan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 62757088) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 2-(azepan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-(azepan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 62757088 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2-(azepan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | O=C1CCCc2nc(N3CCCCCC3)sc21 |
| InChI | InChI=1S/C13H18N2OS/c16-11-7-5-6-10-12(11)17-13(14-10)15-8-3-1-2-4-9-15/h1-9H2 |
| InChIKey | OEVJQDHOBRHAIC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |