C14H20N2OS — CID 62757458
2-(azocan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one (PubChem CID 62757458) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-(azocan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one.
| Compound Name | 2-(azocan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 62757458 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-(azocan-1-yl)-5,6-dihydro-4H-1,3-benzothiazol-7-one |
| SMILES | O=C1CCCc2nc(N3CCCCCCC3)sc21 |
| InChI | InChI=1S/C14H20N2OS/c17-12-8-6-7-11-13(12)18-14(15-11)16-9-4-2-1-3-5-10-16/h1-10H2 |
| InChIKey | HMGPEXWHCCXTFH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |