C10H21N5O — CID 62762419
N-methyl-1-[1-[2-(3-methylbutoxy)ethyl]tetrazol-5-yl]methanamine (PubChem CID 62762419) has the molecular formula C10H21N5O and a molecular weight of 227.31 g/mol. Its IUPAC name is N-methyl-1-[1-[2-(3-methylbutoxy)ethyl]tetrazol-5-yl]methanamine.
| Compound Name | N-methyl-1-[1-[2-(3-methylbutoxy)ethyl]tetrazol-5-yl]methanamine |
|---|---|
| PubChem CID | 62762419 |
| Molecular Formula | C10H21N5O |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-methyl-1-[1-[2-(3-methylbutoxy)ethyl]tetrazol-5-yl]methanamine |
| SMILES | CNCc1nnnn1CCOCCC(C)C |
| InChI | InChI=1S/C10H21N5O/c1-9(2)4-6-16-7-5-15-10(8-11-3)12-13-14-15/h9,11H,4-8H2,1-3H3 |
| InChIKey | BFGBBPWZAPFLKZ-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|