C9H12N4O2S — CID 62795384
4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]piperazin-2-one (PubChem CID 62795384) has the molecular formula C9H12N4O2S and a molecular weight of 240.29 g/mol. Its IUPAC name is 4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]piperazin-2-one.
| Compound Name | 4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]piperazin-2-one |
|---|---|
| PubChem CID | 62795384 |
| Molecular Formula | C9H12N4O2S |
| Molecular Weight | 240.29 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]piperazin-2-one |
| SMILES | Nc1nc(CC(=O)N2CCNC(=O)C2)cs1 |
| InChI | InChI=1S/C9H12N4O2S/c10-9-12-6(5-16-9)3-8(15)13-2-1-11-7(14)4-13/h5H,1-4H2,(H2,10,12)(H,11,14) |
| InChIKey | DURJTMBXLDTGFB-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.29 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |