C14H16N4O2S — CID 62799063
3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-N-ethylbenzamide (PubChem CID 62799063) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is 3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 62799063 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)Cc2csc(N)n2)c1 |
| InChI | InChI=1S/C14H16N4O2S/c1-2-16-13(20)9-4-3-5-10(6-9)17-12(19)7-11-8-21-14(15)18-11/h3-6,8H,2,7H2,1H3,(H2,15,18)(H,16,20)(H,17,19) |
| InChIKey | LPWJNLDJRXKMBP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |