C9H10BrClO2S — CID 62805836
2-[bromo-(5-chlorothiophen-2-yl)methyl]-1,4-dioxane (PubChem CID 62805836) has the molecular formula C9H10BrClO2S and a molecular weight of 297.60 g/mol. Its IUPAC name is 2-[bromo-(5-chlorothiophen-2-yl)methyl]-1,4-dioxane.
| Compound Name | 2-[bromo-(5-chlorothiophen-2-yl)methyl]-1,4-dioxane |
|---|---|
| PubChem CID | 62805836 |
| Molecular Formula | C9H10BrClO2S |
| Molecular Weight | 297.60 g/mol |
| Exact Mass | 295.93 |
| IUPAC Name | 2-[bromo-(5-chlorothiophen-2-yl)methyl]-1,4-dioxane |
| SMILES | Clc1ccc(C(Br)C2COCCO2)s1 |
| InChI | InChI=1S/C9H10BrClO2S/c10-9(6-5-12-3-4-13-6)7-1-2-8(11)14-7/h1-2,6,9H,3-5H2 |
| InChIKey | VIRBJHOWEQVPMH-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.60 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|