C9H7ClN6O3 — CID 62807360
3-amino-N-(5-chloro-2-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62807360) has the molecular formula C9H7ClN6O3 and a molecular weight of 282.65 g/mol. Its IUPAC name is 3-amino-N-(5-chloro-2-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(5-chloro-2-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 62807360 |
| Molecular Formula | C9H7ClN6O3 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 3-amino-N-(5-chloro-2-nitrophenyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)Nc2cc(Cl)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C9H7ClN6O3/c10-4-1-2-6(16(18)19)5(3-4)12-8(17)7-13-9(11)15-14-7/h1-3H,(H,12,17)(H3,11,13,14,15) |
| InChIKey | QHZXELVJDODVLZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 139.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|