C12H15F3N2O — CID 62815370
N-butyl-2-(2,4,5-trifluoroanilino)acetamide (PubChem CID 62815370) has the molecular formula C12H15F3N2O and a molecular weight of 260.26 g/mol. Its IUPAC name is N-butyl-2-(2,4,5-trifluoroanilino)acetamide.
| Compound Name | N-butyl-2-(2,4,5-trifluoroanilino)acetamide |
|---|---|
| PubChem CID | 62815370 |
| Molecular Formula | C12H15F3N2O |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.11 |
| IUPAC Name | N-butyl-2-(2,4,5-trifluoroanilino)acetamide |
| SMILES | CCCCNC(=O)CNc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H15F3N2O/c1-2-3-4-16-12(18)7-17-11-6-9(14)8(13)5-10(11)15/h5-6,17H,2-4,7H2,1H3,(H,16,18) |
| InChIKey | IZSKGWZEFCLWIH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|