C15H19N3O2S — CID 62816363
2-(5-amino-2-oxo-1-pyridinyl)-N-(1-thiophen-2-ylbutyl)acetamide (PubChem CID 62816363) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 2-(5-amino-2-oxo-1-pyridinyl)-N-(1-thiophen-2-ylbutyl)acetamide.
| Compound Name | 2-(5-amino-2-oxo-1-pyridinyl)-N-(1-thiophen-2-ylbutyl)acetamide |
|---|---|
| PubChem CID | 62816363 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-(5-amino-2-oxo-1-pyridinyl)-N-(1-thiophen-2-ylbutyl)acetamide |
| SMILES | CCCC(NC(=O)Cn1cc(N)ccc1=O)c1cccs1 |
| InChI | InChI=1S/C15H19N3O2S/c1-2-4-12(13-5-3-8-21-13)17-14(19)10-18-9-11(16)6-7-15(18)20/h3,5-9,12H,2,4,10,16H2,1H3,(H,17,19) |
| InChIKey | VDYLAIUEIJNDCM-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |