C15H24N2O4 — CID 62818999
2-[[5-(diethylaminomethyl)furan-2-carbonyl]-methylamino]-2-methylpropanoic acid (PubChem CID 62818999) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[[5-(diethylaminomethyl)furan-2-carbonyl]-methylamino]-2-methylpropanoic acid.
| Compound Name | 2-[[5-(diethylaminomethyl)furan-2-carbonyl]-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 62818999 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[[5-(diethylaminomethyl)furan-2-carbonyl]-methylamino]-2-methylpropanoic acid |
| SMILES | CCN(CC)Cc1ccc(C(=O)N(C)C(C)(C)C(=O)O)o1 |
| InChI | InChI=1S/C15H24N2O4/c1-6-17(7-2)10-11-8-9-12(21-11)13(18)16(5)15(3,4)14(19)20/h8-9H,6-7,10H2,1-5H3,(H,19,20) |
| InChIKey | RGPDUSPBFITWTA-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |