C12H20N4O4 — CID 62824824
2-[4-(3-oxopiperazine-1-carbonyl)-1,4-diazepan-1-yl]acetic acid (PubChem CID 62824824) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[4-(3-oxopiperazine-1-carbonyl)-1,4-diazepan-1-yl]acetic acid.
| Compound Name | 2-[4-(3-oxopiperazine-1-carbonyl)-1,4-diazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 62824824 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 2-[4-(3-oxopiperazine-1-carbonyl)-1,4-diazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCN(C(=O)N2CCNC(=O)C2)CC1 |
| InChI | InChI=1S/C12H20N4O4/c17-10-8-16(5-2-13-10)12(20)15-4-1-3-14(6-7-15)9-11(18)19/h1-9H2,(H,13,17)(H,18,19) |
| InChIKey | LWRQIPDPPTVUPZ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |