C28H46N10O16 — CID 71344677
2-[5,11,18,21,24-pentakis(carboxymethyl)-3,13,16,26-tetraoxo-1,2,5,8,11,14,15,18,21,24-decazacyclohexacos-8-yl]acetic acid (PubChem CID 71344677) has the molecular formula C28H46N10O16 and a molecular weight of 778.73 g/mol. Its IUPAC name is 2-[5,11,18,21,24-pentakis(carboxymethyl)-3,13,16,26-tetraoxo-1,2,5,8,11,14,15,18,21,24-decazacyclohexacos-8-yl]acetic acid.
| Compound Name | 2-[5,11,18,21,24-pentakis(carboxymethyl)-3,13,16,26-tetraoxo-1,2,5,8,11,14,15,18,21,24-decazacyclohexacos-8-yl]acetic acid |
|---|---|
| PubChem CID | 71344677 |
| Molecular Formula | C28H46N10O16 |
| Molecular Weight | 778.73 g/mol |
| Exact Mass | 778.31 |
| IUPAC Name | 2-[5,11,18,21,24-pentakis(carboxymethyl)-3,13,16,26-tetraoxo-1,2,5,8,11,14,15,18,21,24-decazacyclohexacos-8-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC(=O)O)CC(=O)NNC(=O)CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC(=O)NNC(=O)CN(CC(=O)O)CC1 |
| InChI | InChI=1S/C28H46N10O16/c39-19-9-35(15-25(47)48)5-1-33(13-23(43)44)2-6-36(16-26(49)50)10-20(40)31-32-22(42)12-38(18-28(53)54)8-4-34(14-24(45)46)3-7-37(17-27(51)52)11-21(41)30-29-19/h1-18H2,(H,29,39)(H,30,41)(H,31,40)(H,32,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | FCWOWGVFPINJIP-UHFFFAOYSA-N |
| XLogP | -7.39 |
| TPSA | 359.64 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.73 |
| LogP ≤ 5 | -7.39 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |