C10H16AlN2O9 — CID 16686094
CID 16686094 (PubChem CID 16686094) has the molecular formula C10H16AlN2O9 and a molecular weight of 335.23 g/mol.
| Compound Name | CID 16686094 |
|---|---|
| PubChem CID | 16686094 |
| Molecular Formula | C10H16AlN2O9 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | — |
| SMILES | O.O=C(O)CN1CCN(CC(=O)O)CC(=O)O[Al]OC(=O)C1 |
| InChI | InChI=1S/C10H16N2O8.Al.H2O/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;1H2/q;+2;/p-2 |
| InChIKey | FDYSXVXHKRBPSY-UHFFFAOYSA-L |
| XLogP | -3.43 |
| TPSA | 165.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |