About 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine
4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine (PubChem CID 62832586) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine.
Molecular Properties
| Compound Name | 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine |
| PubChem CID | 62832586 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine |
| SMILES | CC1(C)COCCN1CCN1CCCNCC1 |
| InChI | InChI=1S/C13H27N3O/c1-13(2)12-17-11-10-16(13)9-8-15-6-3-4-14-5-7-15/h14H,3-12H2,1-2H3 |
| InChIKey | PYQUXDMEASTAPX-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine?
The IUPAC name of 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine (CID 62832586) is 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine.
What is the SMILES notation for 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine?
The canonical SMILES for 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine is CC1(C)COCCN1CCN1CCCNCC1.
What is the InChIKey of 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine?
The InChIKey is PYQUXDMEASTAPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O/c1-13(2)12-17-11-10-16(13)9-8-15-6-3-4-14-5-7-15/h14H,3-12H2,1-2H3.
What are the key properties of 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine?
4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine has a molecular weight of 241.38 g/mol, XLogP of 0.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(1,4-diazepan-1-yl)ethyl]-3,3-dimethylmorpholine is sourced from PubChem (CID 62832586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).