C13H27N3O2 — CID 62836284
N-[3-(butan-2-ylamino)-3-oxopropyl]-2-(ethylamino)-2-methylpropanamide (PubChem CID 62836284) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is N-[3-(butan-2-ylamino)-3-oxopropyl]-2-(ethylamino)-2-methylpropanamide.
| Compound Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-2-(ethylamino)-2-methylpropanamide |
|---|---|
| PubChem CID | 62836284 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | N-[3-(butan-2-ylamino)-3-oxopropyl]-2-(ethylamino)-2-methylpropanamide |
| SMILES | CCNC(C)(C)C(=O)NCCC(=O)NC(C)CC |
| InChI | InChI=1S/C13H27N3O2/c1-6-10(3)16-11(17)8-9-14-12(18)13(4,5)15-7-2/h10,15H,6-9H2,1-5H3,(H,14,18)(H,16,17) |
| InChIKey | ZZNJACKRZGUYEW-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |