C14H15ClN2O2S2 — CID 62840437
4-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzenesulfonamide (PubChem CID 62840437) has the molecular formula C14H15ClN2O2S2 and a molecular weight of 342.87 g/mol. Its IUPAC name is 4-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzenesulfonamide.
| Compound Name | 4-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 62840437 |
| Molecular Formula | C14H15ClN2O2S2 |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 4-amino-2-chloro-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC2CCCc3sccc32)c(Cl)c1 |
| InChI | InChI=1S/C14H15ClN2O2S2/c15-11-8-9(16)4-5-14(11)21(18,19)17-12-2-1-3-13-10(12)6-7-20-13/h4-8,12,17H,1-3,16H2 |
| InChIKey | XCVDZCKQNHPAPP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|