C15H19N3OS — CID 62844444
1-[3-(1-aminoethyl)phenyl]-3-(1-thiophen-3-ylethyl)urea (PubChem CID 62844444) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-[3-(1-aminoethyl)phenyl]-3-(1-thiophen-3-ylethyl)urea.
| Compound Name | 1-[3-(1-aminoethyl)phenyl]-3-(1-thiophen-3-ylethyl)urea |
|---|---|
| PubChem CID | 62844444 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[3-(1-aminoethyl)phenyl]-3-(1-thiophen-3-ylethyl)urea |
| SMILES | CC(N)c1cccc(NC(=O)NC(C)c2ccsc2)c1 |
| InChI | InChI=1S/C15H19N3OS/c1-10(16)12-4-3-5-14(8-12)18-15(19)17-11(2)13-6-7-20-9-13/h3-11H,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | DOVPDZIQPQHKPS-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |