C15H17ClN4S — CID 62867380
2-benzylsulfanyl-4-chloro-6-piperidin-1-yl-1,3,5-triazine (PubChem CID 62867380) has the molecular formula C15H17ClN4S and a molecular weight of 320.85 g/mol. Its IUPAC name is 2-benzylsulfanyl-4-chloro-6-piperidin-1-yl-1,3,5-triazine.
| Compound Name | 2-benzylsulfanyl-4-chloro-6-piperidin-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 62867380 |
| Molecular Formula | C15H17ClN4S |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 2-benzylsulfanyl-4-chloro-6-piperidin-1-yl-1,3,5-triazine |
| SMILES | Clc1nc(SCc2ccccc2)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H17ClN4S/c16-13-17-14(20-9-5-2-6-10-20)19-15(18-13)21-11-12-7-3-1-4-8-12/h1,3-4,7-8H,2,5-6,9-11H2 |
| InChIKey | HQFGAOPWVKZJKR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |