C11H9N5S — CID 62876398
4-amino-3-quinolin-5-yl-1H-1,2,4-triazole-5-thione (PubChem CID 62876398) has the molecular formula C11H9N5S and a molecular weight of 243.30 g/mol. Its IUPAC name is 4-amino-3-quinolin-5-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-quinolin-5-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 62876398 |
| Molecular Formula | C11H9N5S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 4-amino-3-quinolin-5-yl-1H-1,2,4-triazole-5-thione |
| SMILES | Nn1c(-c2cccc3ncccc23)n[nH]c1=S |
| InChI | InChI=1S/C11H9N5S/c12-16-10(14-15-11(16)17)8-3-1-5-9-7(8)4-2-6-13-9/h1-6H,12H2,(H,15,17) |
| InChIKey | WDGHZGMWMVFQRE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|