C11H9IN4 — CID 146871098
3-quinolin-5-yl-1λ3-ioda-2,4-diazacyclopenta-3,5-dien-2-amine (PubChem CID 146871098) has the molecular formula C11H9IN4 and a molecular weight of 324.12 g/mol. Its IUPAC name is 3-quinolin-5-yl-1λ3-ioda-2,4-diazacyclopenta-3,5-dien-2-amine.
| Compound Name | 3-quinolin-5-yl-1λ3-ioda-2,4-diazacyclopenta-3,5-dien-2-amine |
|---|---|
| PubChem CID | 146871098 |
| Molecular Formula | C11H9IN4 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 3-quinolin-5-yl-1λ3-ioda-2,4-diazacyclopenta-3,5-dien-2-amine |
| SMILES | NN1I=CN=C1c1cccc2ncccc12 |
| InChI | InChI=1S/C11H9IN4/c13-16-11(15-7-12-16)9-3-1-5-10-8(9)4-2-6-14-10/h1-7H,13H2 |
| InChIKey | SOAYZYGWCAGJCU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|