C17H17Cl2N3OS — CID 6287661
[(Z)-[5-[(2,5-dichlorophenyl)sulfanylmethyl]-2,4-dimethylphenyl]methylideneamino]urea (PubChem CID 6287661) has the molecular formula C17H17Cl2N3OS and a molecular weight of 382.32 g/mol. Its IUPAC name is [(Z)-[5-[(2,5-dichlorophenyl)sulfanylmethyl]-2,4-dimethylphenyl]methylideneamino]urea.
| Compound Name | [(Z)-[5-[(2,5-dichlorophenyl)sulfanylmethyl]-2,4-dimethylphenyl]methylideneamino]urea |
|---|---|
| PubChem CID | 6287661 |
| Molecular Formula | C17H17Cl2N3OS |
| Molecular Weight | 382.32 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | [(Z)-[5-[(2,5-dichlorophenyl)sulfanylmethyl]-2,4-dimethylphenyl]methylideneamino]urea |
| SMILES | Cc1cc(C)c(CSc2cc(Cl)ccc2Cl)cc1/C=N\NC(N)=O |
| InChI | InChI=1S/C17H17Cl2N3OS/c1-10-5-11(2)13(6-12(10)8-21-22-17(20)23)9-24-16-7-14(18)3-4-15(16)19/h3-8H,9H2,1-2H3,(H3,20,22,23)/b21-8- |
| InChIKey | RXXKXIBDVCMIQH-WNFQYIGGSA-N |
| XLogP | 4.90 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|