C11H11FN4O3S — CID 62884133
2-amino-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzoic acid (PubChem CID 62884133) has the molecular formula C11H11FN4O3S and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-amino-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzoic acid.
| Compound Name | 2-amino-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 62884133 |
| Molecular Formula | C11H11FN4O3S |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-amino-5-[(4-ethyl-5-oxo-1H-1,2,4-triazol-3-yl)sulfanyl]-4-fluorobenzoic acid |
| SMILES | CCn1c(Sc2cc(C(=O)O)c(N)cc2F)n[nH]c1=O |
| InChI | InChI=1S/C11H11FN4O3S/c1-2-16-10(19)14-15-11(16)20-8-3-5(9(17)18)7(13)4-6(8)12/h3-4H,2,13H2,1H3,(H,14,19)(H,17,18) |
| InChIKey | SRESJWXJKYCDMM-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 114.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|