C12H15N5S — CID 62893738
3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide (PubChem CID 62893738) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide.
| Compound Name | 3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 62893738 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 3-[(2,5-dimethylpyrazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ncccc1CSc1cc(C)nn1C |
| InChI | InChI=1S/C12H15N5S/c1-8-6-10(17(2)16-8)18-7-9-4-3-5-15-11(9)12(13)14/h3-6H,7H2,1-2H3,(H3,13,14) |
| InChIKey | UUHNCOHYKUSBGC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|