C9H12N2O3S2 — CID 62897265
4-thiophen-2-ylsulfonyl-1,4-diazepan-2-one (PubChem CID 62897265) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-thiophen-2-ylsulfonyl-1,4-diazepan-2-one.
| Compound Name | 4-thiophen-2-ylsulfonyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62897265 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-thiophen-2-ylsulfonyl-1,4-diazepan-2-one |
| SMILES | O=C1CN(S(=O)(=O)c2cccs2)CCCN1 |
| InChI | InChI=1S/C9H12N2O3S2/c12-8-7-11(5-2-4-10-8)16(13,14)9-3-1-6-15-9/h1,3,6H,2,4-5,7H2,(H,10,12) |
| InChIKey | CAAJLYWIJJGZMD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |